C17H17NO4 — CID 177420512
methyl 2-(2,3-dihydrofuran-4-yl)-3-(3-methylindol-1-yl)-3-oxopropanoate (PubChem CID 177420512) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is methyl 2-(2,3-dihydrofuran-4-yl)-3-(3-methylindol-1-yl)-3-oxopropanoate.
| Compound Name | methyl 2-(2,3-dihydrofuran-4-yl)-3-(3-methylindol-1-yl)-3-oxopropanoate |
|---|---|
| PubChem CID | 177420512 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | methyl 2-(2,3-dihydrofuran-4-yl)-3-(3-methylindol-1-yl)-3-oxopropanoate |
| SMILES | COC(=O)C(C(=O)n1cc(C)c2ccccc21)C1=COCC1 |
| InChI | InChI=1S/C17H17NO4/c1-11-9-18(14-6-4-3-5-13(11)14)16(19)15(17(20)21-2)12-7-8-22-10-12/h3-6,9-10,15H,7-8H2,1-2H3 |
| InChIKey | VXWUKJFUEVZPOA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|