About [benzoyl-bis(6-bromo-1,2-dihydroacenaphthylen-5-yl)stannyl]-phenylmethanone
[benzoyl-bis(6-bromo-1,2-dihydroacenaphthylen-5-yl)stannyl]-phenylmethanone (PubChem CID 177420679) has the molecular formula C38H26Br2O2Sn
and a molecular weight of 793.14 g/mol. Its IUPAC name is [benzoyl-bis(6-bromo-1,2-dihydroacenaphthylen-5-yl)stannyl]-phenylmethanone.
Molecular Properties
| Compound Name | [benzoyl-bis(6-bromo-1,2-dihydroacenaphthylen-5-yl)stannyl]-phenylmethanone |
| PubChem CID | 177420679 |
| Molecular Formula | C38H26Br2O2Sn |
| Molecular Weight | 793.14 g/mol |
| Exact Mass | 791.93 |
| IUPAC Name | [benzoyl-bis(6-bromo-1,2-dihydroacenaphthylen-5-yl)stannyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[Sn](C(=O)c1ccccc1)(c1ccc2c3c(ccc(Br)c13)CC2)c1ccc2c3c(ccc(Br)c13)CC2 |
| InChI | InChI=1S/2C12H8Br.2C7H5O.Sn/c2*13-11-7-6-9-5-4-8-2-1-3-10(11)12(8)9;2*8-6-7-4-2-1-3-5-7;/h2*1-2,6-7H,4-5H2;2*1-5H; |
| InChIKey | RMOLFHCNIGPEEW-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 793.14 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [benzoyl-bis(6-bromo-1,2-dihydroacenaphthylen-5-yl)stannyl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [benzoyl-bis(6-bromo-1,2-dihydroacenaphthylen-5-yl)stannyl]-phenylmethanone?
The IUPAC name of [benzoyl-bis(6-bromo-1,2-dihydroacenaphthylen-5-yl)stannyl]-phenylmethanone (CID 177420679) is [benzoyl-bis(6-bromo-1,2-dihydroacenaphthylen-5-yl)stannyl]-phenylmethanone.
What is the SMILES notation for [benzoyl-bis(6-bromo-1,2-dihydroacenaphthylen-5-yl)stannyl]-phenylmethanone?
The canonical SMILES for [benzoyl-bis(6-bromo-1,2-dihydroacenaphthylen-5-yl)stannyl]-phenylmethanone is O=C(c1ccccc1)[Sn](C(=O)c1ccccc1)(c1ccc2c3c(ccc(Br)c13)CC2)c1ccc2c3c(ccc(Br)c13)CC2.
What is the InChIKey of [benzoyl-bis(6-bromo-1,2-dihydroacenaphthylen-5-yl)stannyl]-phenylmethanone?
The InChIKey is RMOLFHCNIGPEEW-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H8Br.2C7H5O.Sn/c2*13-11-7-6-9-5-4-8-2-1-3-10(11)12(8)9;2*8-6-7-4-2-1-3-5-7;/h2*1-2,6-7H,4-5H2;2*1-5H;.
What are the key properties of [benzoyl-bis(6-bromo-1,2-dihydroacenaphthylen-5-yl)stannyl]-phenylmethanone?
[benzoyl-bis(6-bromo-1,2-dihydroacenaphthylen-5-yl)stannyl]-phenylmethanone has a molecular weight of 793.14 g/mol, XLogP of 8.12, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [benzoyl-bis(6-bromo-1,2-dihydroacenaphthylen-5-yl)stannyl]-phenylmethanone is sourced from PubChem (CID 177420679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).