C15H20O3 — CID 177420963
(4aR,6R,7aS,7bR)-3,6,7b-trimethyl-2-oxo-1,4,4a,5,7,7a-hexahydrocyclobuta[e]indene-6-carboxylic acid (PubChem CID 177420963) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (4aR,6R,7aS,7bR)-3,6,7b-trimethyl-2-oxo-1,4,4a,5,7,7a-hexahydrocyclobuta[e]indene-6-carboxylic acid.
| Compound Name | (4aR,6R,7aS,7bR)-3,6,7b-trimethyl-2-oxo-1,4,4a,5,7,7a-hexahydrocyclobuta[e]indene-6-carboxylic acid |
|---|---|
| PubChem CID | 177420963 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (4aR,6R,7aS,7bR)-3,6,7b-trimethyl-2-oxo-1,4,4a,5,7,7a-hexahydrocyclobuta[e]indene-6-carboxylic acid |
| SMILES | CC1=C2C(=O)C[C@]2(C)[C@H]2C[C@](C)(C(=O)O)C[C@H]2C1 |
| InChI | InChI=1S/C15H20O3/c1-8-4-9-5-14(2,13(17)18)6-10(9)15(3)7-11(16)12(8)15/h9-10H,4-7H2,1-3H3,(H,17,18)/t9-,10+,14-,15-/m1/s1 |
| InChIKey | JNYLXKYGYUANGD-ANGCBRKESA-N |
| XLogP | 2.80 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |