About magnesium bis((3S)-3-amino-4-oxobutanoic acid)
magnesium bis((3S)-3-amino-4-oxobutanoic acid) (PubChem CID 177421154) has the molecular formula C8H12MgN2O6
and a molecular weight of 256.50 g/mol. Its IUPAC name is magnesium bis((3S)-3-amino-4-oxobutanoic acid).
Molecular Properties
| Compound Name | magnesium bis((3S)-3-amino-4-oxobutanoic acid) |
| PubChem CID | 177421154 |
| Molecular Formula | C8H12MgN2O6 |
| Molecular Weight | 256.50 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | magnesium bis((3S)-3-amino-4-oxobutanoic acid) |
| SMILES | N[C@H]([C-]=O)CC(=O)O.N[C@H]([C-]=O)CC(=O)O.[Mg+2] |
| InChI | InChI=1S/2C4H6NO3.Mg/c2*5-3(2-6)1-4(7)8;/h2*3H,1,5H2,(H,7,8);/q2*-1;+2/t2*3-;/m00./s1 |
| InChIKey | VVHNRZFJYKMGBD-QHTZZOMLSA-N |
| XLogP | -2.58 |
| TPSA | 160.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.50 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze magnesium bis((3S)-3-amino-4-oxobutanoic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium bis((3S)-3-amino-4-oxobutanoic acid)?
The IUPAC name of magnesium bis((3S)-3-amino-4-oxobutanoic acid) (CID 177421154) is magnesium bis((3S)-3-amino-4-oxobutanoic acid).
What is the SMILES notation for magnesium bis((3S)-3-amino-4-oxobutanoic acid)?
The canonical SMILES for magnesium bis((3S)-3-amino-4-oxobutanoic acid) is N[C@H]([C-]=O)CC(=O)O.N[C@H]([C-]=O)CC(=O)O.[Mg+2].
What is the InChIKey of magnesium bis((3S)-3-amino-4-oxobutanoic acid)?
The InChIKey is VVHNRZFJYKMGBD-QHTZZOMLSA-N. The full InChI is InChI=1S/2C4H6NO3.Mg/c2*5-3(2-6)1-4(7)8;/h2*3H,1,5H2,(H,7,8);/q2*-1;+2/t2*3-;/m00./s1.
What are the key properties of magnesium bis((3S)-3-amino-4-oxobutanoic acid)?
magnesium bis((3S)-3-amino-4-oxobutanoic acid) has a molecular weight of 256.50 g/mol, XLogP of -2.58, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium bis((3S)-3-amino-4-oxobutanoic acid) is sourced from PubChem (CID 177421154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).