C16H21OSi2- — CID 177421439
cyclohepta-1,4,6-trien-1-yl-[cyclopenta-1,2,4-trien-1-yl(dimethyl)silyl]oxy-dimethylsilane (PubChem CID 177421439) has the molecular formula C16H21OSi2- and a molecular weight of 285.51 g/mol. Its IUPAC name is cyclohepta-1,4,6-trien-1-yl-[cyclopenta-1,2,4-trien-1-yl(dimethyl)silyl]oxy-dimethylsilane.
| Compound Name | cyclohepta-1,4,6-trien-1-yl-[cyclopenta-1,2,4-trien-1-yl(dimethyl)silyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 177421439 |
| Molecular Formula | C16H21OSi2- |
| Molecular Weight | 285.51 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | cyclohepta-1,4,6-trien-1-yl-[cyclopenta-1,2,4-trien-1-yl(dimethyl)silyl]oxy-dimethylsilane |
| SMILES | C[Si](C)(O[Si](C)(C)C1=C[CH-]C=CC=C1)C1=C=CC=C1 |
| InChI | InChI=1S/C16H21OSi2/c1-18(2,15-11-7-5-6-8-12-15)17-19(3,4)16-13-9-10-14-16/h5-13H,1-4H3/q-1 |
| InChIKey | YLGLJKWFYYVTQN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|