About CID 177421590
CID 177421590 (PubChem CID 177421590) has the molecular formula C31H50N4O8
and a molecular weight of 606.76 g/mol.
Molecular Properties
| Compound Name | CID 177421590 |
| PubChem CID | 177421590 |
| Molecular Formula | C31H50N4O8 |
| Molecular Weight | 606.76 g/mol |
| Exact Mass | 606.36 |
| IUPAC Name | — |
| SMILES | CC(=O)N1CCC2(CC1)CC1(CC(C)(C)N2[O])OCC2(CO1)COC1(CC(C)(C)N([O])C3(CCN(C(C)=O)CC3)C1)OC2 |
| InChI | InChI=1S/C31H50N4O8/c1-23(36)32-11-7-28(8-12-32)17-30(15-25(3,4)34(28)38)40-19-27(20-41-30)21-42-31(43-22-27)16-26(5,6)35(39)29(18-31)9-13-33(14-10-29)24(2)37/h7-22H2,1-6H3 |
| InChIKey | PRWDEPGLPVVTOA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 123.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 606.76 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze CID 177421590 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177421590?
The IUPAC name of CID 177421590 (CID 177421590) is not available.
What is the SMILES notation for CID 177421590?
The canonical SMILES for CID 177421590 is CC(=O)N1CCC2(CC1)CC1(CC(C)(C)N2[O])OCC2(CO1)COC1(CC(C)(C)N([O])C3(CCN(C(C)=O)CC3)C1)OC2.
What is the InChIKey of CID 177421590?
The InChIKey is PRWDEPGLPVVTOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H50N4O8/c1-23(36)32-11-7-28(8-12-32)17-30(15-25(3,4)34(28)38)40-19-27(20-41-30)21-42-31(43-22-27)16-26(5,6)35(39)29(18-31)9-13-33(14-10-29)24(2)37/h7-22H2,1-6H3.
What are the key properties of CID 177421590?
CID 177421590 has a molecular weight of 606.76 g/mol, XLogP of 2.66, 0 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177421590 is sourced from PubChem (CID 177421590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).