C31H28N2OS2 — CID 177421608
N,N,4-tris(4-methylphenyl)-2-(4-methylsulfinylphenyl)-1,3-thiazol-5-amine (PubChem CID 177421608) has the molecular formula C31H28N2OS2 and a molecular weight of 508.71 g/mol. Its IUPAC name is N,N,4-tris(4-methylphenyl)-2-(4-methylsulfinylphenyl)-1,3-thiazol-5-amine.
| Compound Name | N,N,4-tris(4-methylphenyl)-2-(4-methylsulfinylphenyl)-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 177421608 |
| Molecular Formula | C31H28N2OS2 |
| Molecular Weight | 508.71 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | N,N,4-tris(4-methylphenyl)-2-(4-methylsulfinylphenyl)-1,3-thiazol-5-amine |
| SMILES | Cc1ccc(-c2nc(-c3ccc(S(C)=O)cc3)sc2N(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C31H28N2OS2/c1-21-5-11-24(12-6-21)29-31(35-30(32-29)25-13-19-28(20-14-25)36(4)34)33(26-15-7-22(2)8-16-26)27-17-9-23(3)10-18-27/h5-20H,1-4H3 |
| InChIKey | FBIWWKLKOAEBKJ-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.71 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |