C25H26N2O3 — CID 177421690
N-[(2S)-1-(3,6-dimethoxycarbazol-9-yl)but-3-en-2-yl]-4-methoxyaniline (PubChem CID 177421690) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is N-[(2S)-1-(3,6-dimethoxycarbazol-9-yl)but-3-en-2-yl]-4-methoxyaniline.
| Compound Name | N-[(2S)-1-(3,6-dimethoxycarbazol-9-yl)but-3-en-2-yl]-4-methoxyaniline |
|---|---|
| PubChem CID | 177421690 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | N-[(2S)-1-(3,6-dimethoxycarbazol-9-yl)but-3-en-2-yl]-4-methoxyaniline |
| SMILES | C=C[C@@H](Cn1c2ccc(OC)cc2c2cc(OC)ccc21)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C25H26N2O3/c1-5-17(26-18-6-8-19(28-2)9-7-18)16-27-24-12-10-20(29-3)14-22(24)23-15-21(30-4)11-13-25(23)27/h5-15,17,26H,1,16H2,2-4H3/t17-/m0/s1 |
| InChIKey | VCZUERREAACISB-KRWDZBQOSA-N |
| XLogP | 5.49 |
| TPSA | 44.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|