About (Z,2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hept-4-en-3-one
(Z,2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hept-4-en-3-one (PubChem CID 177421928) has the molecular formula C19H40O3Si2
and a molecular weight of 372.70 g/mol. Its IUPAC name is (Z,2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hept-4-en-3-one.
Molecular Properties
| Compound Name | (Z,2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hept-4-en-3-one |
| PubChem CID | 177421928 |
| Molecular Formula | C19H40O3Si2 |
| Molecular Weight | 372.70 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | (Z,2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hept-4-en-3-one |
| SMILES | CC(/C=C\C(=O)[C@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H40O3Si2/c1-15(21-23(9,10)18(3,4)5)13-14-17(20)16(2)22-24(11,12)19(6,7)8/h13-16H,1-12H3/b14-13-/t15?,16-/m0/s1 |
| InChIKey | IJNAOPKJOUBAIP-UYAARWOYSA-N |
| XLogP | 5.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.70 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z,2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hept-4-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hept-4-en-3-one?
The IUPAC name of (Z,2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hept-4-en-3-one (CID 177421928) is (Z,2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hept-4-en-3-one.
What is the SMILES notation for (Z,2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hept-4-en-3-one?
The canonical SMILES for (Z,2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hept-4-en-3-one is CC(/C=C\C(=O)[C@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of (Z,2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hept-4-en-3-one?
The InChIKey is IJNAOPKJOUBAIP-UYAARWOYSA-N. The full InChI is InChI=1S/C19H40O3Si2/c1-15(21-23(9,10)18(3,4)5)13-14-17(20)16(2)22-24(11,12)19(6,7)8/h13-16H,1-12H3/b14-13-/t15?,16-/m0/s1.
What are the key properties of (Z,2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hept-4-en-3-one?
(Z,2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hept-4-en-3-one has a molecular weight of 372.70 g/mol, XLogP of 5.93, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hept-4-en-3-one is sourced from PubChem (CID 177421928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).