C22H34O5 — CID 177422003
(E,2S)-2-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]-6-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]peroxy-6-methylhept-4-en-3-one (PubChem CID 177422003) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is (E,2S)-2-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]-6-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]peroxy-6-methylhept-4-en-3-one.
| Compound Name | (E,2S)-2-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]-6-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]peroxy-6-methylhept-4-en-3-one |
|---|---|
| PubChem CID | 177422003 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | (E,2S)-2-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]-6-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]peroxy-6-methylhept-4-en-3-one |
| SMILES | C=C[C@@]1(C)CC[C@@H](OOC(C)(C)/C=C/C(=O)[C@@H](C)[C@@H]2CC[C@](C)(C=C)O2)O1 |
| InChI | InChI=1S/C22H34O5/c1-8-21(6)14-11-18(24-21)16(3)17(23)10-13-20(4,5)27-26-19-12-15-22(7,9-2)25-19/h8-10,13,16,18-19H,1-2,11-12,14-15H2,3-7H3/b13-10+/t16-,18+,19-,21+,22+/m1/s1 |
| InChIKey | DNBARWABGSKGCA-UZZKWIEUSA-N |
| XLogP | 4.68 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|