C10H8O5 — CID 177422646
(1R,2R,6S,7S)-3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-ene-10-carboxylic acid (PubChem CID 177422646) has the molecular formula C10H8O5 and a molecular weight of 208.17 g/mol. Its IUPAC name is (1R,2R,6S,7S)-3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-ene-10-carboxylic acid.
| Compound Name | (1R,2R,6S,7S)-3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-ene-10-carboxylic acid |
|---|---|
| PubChem CID | 177422646 |
| Molecular Formula | C10H8O5 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | (1R,2R,6S,7S)-3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-ene-10-carboxylic acid |
| SMILES | O=C(O)C1[C@H]2C=C[C@@H]1[C@@H]1C(=O)OC(=O)[C@@H]12 |
| InChI | InChI=1S/C10H8O5/c11-8(12)5-3-1-2-4(5)7-6(3)9(13)15-10(7)14/h1-7H,(H,11,12)/t3-,4+,5?,6-,7+ |
| InChIKey | OHWQGWDDDVGCEM-PNYSXETKSA-N |
| XLogP | -0.18 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|