About [(4E)-4-[3,5-bis(dimethylamino)fluoren-9-ylidene]naphthalen-1-ylidene]-dimethylazanium
[(4E)-4-[3,5-bis(dimethylamino)fluoren-9-ylidene]naphthalen-1-ylidene]-dimethylazanium (PubChem CID 177422965) has the molecular formula C29H30N3+
and a molecular weight of 420.58 g/mol. Its IUPAC name is [(4E)-4-[3,5-bis(dimethylamino)fluoren-9-ylidene]naphthalen-1-ylidene]-dimethylazanium.
Molecular Properties
| Compound Name | [(4E)-4-[3,5-bis(dimethylamino)fluoren-9-ylidene]naphthalen-1-ylidene]-dimethylazanium |
| PubChem CID | 177422965 |
| Molecular Formula | C29H30N3+ |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | [(4E)-4-[3,5-bis(dimethylamino)fluoren-9-ylidene]naphthalen-1-ylidene]-dimethylazanium |
| SMILES | CN(C)c1ccc2c(c1)-c1c(cccc1N(C)C)/C2=C1\C=CC(=[N+](C)C)c2ccccc21 |
| InChI | InChI=1S/C29H30N3/c1-30(2)19-14-15-23-25(18-19)29-24(12-9-13-27(29)32(5)6)28(23)22-16-17-26(31(3)4)21-11-8-7-10-20(21)22/h7-18H,1-6H3/q+1 |
| InChIKey | IWEGIFNZNODJHG-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze [(4E)-4-[3,5-bis(dimethylamino)fluoren-9-ylidene]naphthalen-1-ylidene]-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4E)-4-[3,5-bis(dimethylamino)fluoren-9-ylidene]naphthalen-1-ylidene]-dimethylazanium?
The IUPAC name of [(4E)-4-[3,5-bis(dimethylamino)fluoren-9-ylidene]naphthalen-1-ylidene]-dimethylazanium (CID 177422965) is [(4E)-4-[3,5-bis(dimethylamino)fluoren-9-ylidene]naphthalen-1-ylidene]-dimethylazanium.
What is the SMILES notation for [(4E)-4-[3,5-bis(dimethylamino)fluoren-9-ylidene]naphthalen-1-ylidene]-dimethylazanium?
The canonical SMILES for [(4E)-4-[3,5-bis(dimethylamino)fluoren-9-ylidene]naphthalen-1-ylidene]-dimethylazanium is CN(C)c1ccc2c(c1)-c1c(cccc1N(C)C)/C2=C1\C=CC(=[N+](C)C)c2ccccc21.
What is the InChIKey of [(4E)-4-[3,5-bis(dimethylamino)fluoren-9-ylidene]naphthalen-1-ylidene]-dimethylazanium?
The InChIKey is IWEGIFNZNODJHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H30N3/c1-30(2)19-14-15-23-25(18-19)29-24(12-9-13-27(29)32(5)6)28(23)22-16-17-26(31(3)4)21-11-8-7-10-20(21)22/h7-18H,1-6H3/q+1.
What are the key properties of [(4E)-4-[3,5-bis(dimethylamino)fluoren-9-ylidene]naphthalen-1-ylidene]-dimethylazanium?
[(4E)-4-[3,5-bis(dimethylamino)fluoren-9-ylidene]naphthalen-1-ylidene]-dimethylazanium has a molecular weight of 420.58 g/mol, XLogP of 5.39, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(4E)-4-[3,5-bis(dimethylamino)fluoren-9-ylidene]naphthalen-1-ylidene]-dimethylazanium is sourced from PubChem (CID 177422965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).