C12H20O3 — CID 177423055
(2R,4S,5E)-4-hydroxy-2-propyl-2,3,4,7,8,9-hexahydrooxecin-10-one (PubChem CID 177423055) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is (2R,4S,5E)-4-hydroxy-2-propyl-2,3,4,7,8,9-hexahydrooxecin-10-one.
| Compound Name | (2R,4S,5E)-4-hydroxy-2-propyl-2,3,4,7,8,9-hexahydrooxecin-10-one |
|---|---|
| PubChem CID | 177423055 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (2R,4S,5E)-4-hydroxy-2-propyl-2,3,4,7,8,9-hexahydrooxecin-10-one |
| SMILES | CCC[C@@H]1C[C@H](O)/C=C/CCCC(=O)O1 |
| InChI | InChI=1S/C12H20O3/c1-2-6-11-9-10(13)7-4-3-5-8-12(14)15-11/h4,7,10-11,13H,2-3,5-6,8-9H2,1H3/b7-4+/t10-,11-/m1/s1 |
| InChIKey | IWZXZFNLDPFUKQ-OZSGMGSPSA-N |
| XLogP | 2.19 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|