C15H15NO2S — CID 177423409
10-prop-2-enoyl-3,4,4a,10a-tetrahydro-2H-phenothiazin-1-one (PubChem CID 177423409) has the molecular formula C15H15NO2S and a molecular weight of 273.36 g/mol. Its IUPAC name is 10-prop-2-enoyl-3,4,4a,10a-tetrahydro-2H-phenothiazin-1-one.
| Compound Name | 10-prop-2-enoyl-3,4,4a,10a-tetrahydro-2H-phenothiazin-1-one |
|---|---|
| PubChem CID | 177423409 |
| Molecular Formula | C15H15NO2S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 10-prop-2-enoyl-3,4,4a,10a-tetrahydro-2H-phenothiazin-1-one |
| SMILES | C=CC(=O)N1c2ccccc2SC2CCCC(=O)C21 |
| InChI | InChI=1S/C15H15NO2S/c1-2-14(18)16-10-6-3-4-8-12(10)19-13-9-5-7-11(17)15(13)16/h2-4,6,8,13,15H,1,5,7,9H2 |
| InChIKey | WCQJQHXYFZXWAS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|