C23H38O2 — CID 177424524
(5E,9E,11R,13E,15S)-16-tert-butyl-5,9,11,15-tetramethyl-1-oxacyclohexadeca-5,9,13-trien-2-one (PubChem CID 177424524) has the molecular formula C23H38O2 and a molecular weight of 346.56 g/mol. Its IUPAC name is (5E,9E,11R,13E,15S)-16-tert-butyl-5,9,11,15-tetramethyl-1-oxacyclohexadeca-5,9,13-trien-2-one.
| Compound Name | (5E,9E,11R,13E,15S)-16-tert-butyl-5,9,11,15-tetramethyl-1-oxacyclohexadeca-5,9,13-trien-2-one |
|---|---|
| PubChem CID | 177424524 |
| Molecular Formula | C23H38O2 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.29 |
| IUPAC Name | (5E,9E,11R,13E,15S)-16-tert-butyl-5,9,11,15-tetramethyl-1-oxacyclohexadeca-5,9,13-trien-2-one |
| SMILES | C/C1=C\[C@H](C)C/C=C/[C@H](C)C(C(C)(C)C)OC(=O)CC/C(C)=C/CC1 |
| InChI | InChI=1S/C23H38O2/c1-17-10-8-11-18(2)16-19(3)12-9-13-20(4)22(23(5,6)7)25-21(24)15-14-17/h9-10,13,16,19-20,22H,8,11-12,14-15H2,1-7H3/b13-9+,17-10+,18-16+/t19-,20+,22?/m1/s1 |
| InChIKey | GAHJVZYYAICQBT-FBSMHPCXSA-N |
| XLogP | 6.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|