C15H8F6Li2S2 — CID 177424625
dilithium;4-[3,3,4,4,5,5-hexafluoro-2-(5-methyl-2H-thiophen-2-id-4-yl)cyclopenten-1-yl]-5-methyl-2H-thiophen-2-ide (PubChem CID 177424625) has the molecular formula C15H8F6Li2S2 and a molecular weight of 380.23 g/mol. Its IUPAC name is dilithium;4-[3,3,4,4,5,5-hexafluoro-2-(5-methyl-2H-thiophen-2-id-4-yl)cyclopenten-1-yl]-5-methyl-2H-thiophen-2-ide.
| Compound Name | dilithium;4-[3,3,4,4,5,5-hexafluoro-2-(5-methyl-2H-thiophen-2-id-4-yl)cyclopenten-1-yl]-5-methyl-2H-thiophen-2-ide |
|---|---|
| PubChem CID | 177424625 |
| Molecular Formula | C15H8F6Li2S2 |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | dilithium;4-[3,3,4,4,5,5-hexafluoro-2-(5-methyl-2H-thiophen-2-id-4-yl)cyclopenten-1-yl]-5-methyl-2H-thiophen-2-ide |
| SMILES | Cc1s[c-]cc1C1=C(c2c[c-]sc2C)C(F)(F)C(F)(F)C1(F)F.[Li+].[Li+] |
| InChI | InChI=1S/C15H8F6S2.2Li/c1-7-9(3-5-22-7)11-12(10-4-6-23-8(10)2)14(18,19)15(20,21)13(11,16)17;;/h3-4H,1-2H3;;/q-2;2*+1 |
| InChIKey | QIRZESUKDPTFMC-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|