C11H22LiN2S2+ — CID 177424668
lithium 1,3-dimethyl-2-[2-methyl-1,1-bis(methylsulfanyl)propan-2-yl]-4,5-dihydroimidazol-1-ium (PubChem CID 177424668) has the molecular formula C11H22LiN2S2+ and a molecular weight of 253.39 g/mol. Its IUPAC name is lithium 1,3-dimethyl-2-[2-methyl-1,1-bis(methylsulfanyl)propan-2-yl]-4,5-dihydroimidazol-1-ium.
| Compound Name | lithium 1,3-dimethyl-2-[2-methyl-1,1-bis(methylsulfanyl)propan-2-yl]-4,5-dihydroimidazol-1-ium |
|---|---|
| PubChem CID | 177424668 |
| Molecular Formula | C11H22LiN2S2+ |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | lithium 1,3-dimethyl-2-[2-methyl-1,1-bis(methylsulfanyl)propan-2-yl]-4,5-dihydroimidazol-1-ium |
| SMILES | CS[C-](SC)C(C)(C)C1=[N+](C)CCN1C.[Li+] |
| InChI | InChI=1S/C11H22N2S2.Li/c1-11(2,10(14-5)15-6)9-12(3)7-8-13(9)4;/h7-8H2,1-6H3;/q;+1 |
| InChIKey | QWYFLZPLMQSGTQ-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|