C21H16FNO5 — CID 177425154
3-(5,7-dimethoxy-2-oxochromen-3-yl)-7-fluoro-1-methylquinolin-2-one (PubChem CID 177425154) has the molecular formula C21H16FNO5 and a molecular weight of 381.36 g/mol. Its IUPAC name is 3-(5,7-dimethoxy-2-oxochromen-3-yl)-7-fluoro-1-methylquinolin-2-one.
| Compound Name | 3-(5,7-dimethoxy-2-oxochromen-3-yl)-7-fluoro-1-methylquinolin-2-one |
|---|---|
| PubChem CID | 177425154 |
| Molecular Formula | C21H16FNO5 |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 3-(5,7-dimethoxy-2-oxochromen-3-yl)-7-fluoro-1-methylquinolin-2-one |
| SMILES | COc1cc(OC)c2cc(-c3cc4ccc(F)cc4n(C)c3=O)c(=O)oc2c1 |
| InChI | InChI=1S/C21H16FNO5/c1-23-17-7-12(22)5-4-11(17)6-14(20(23)24)15-10-16-18(27-3)8-13(26-2)9-19(16)28-21(15)25/h4-10H,1-3H3 |
| InChIKey | YDIKRJCDURUDMQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 70.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|