About 3-(5,7-dimethoxy-2-oxochromen-3-yl)-7-fluoro-1-methylquinolin-2-one
3-(5,7-dimethoxy-2-oxochromen-3-yl)-7-fluoro-1-methylquinolin-2-one (PubChem CID 177425154) has the molecular formula C21H16FNO5
and a molecular weight of 381.36 g/mol. Its IUPAC name is 3-(5,7-dimethoxy-2-oxochromen-3-yl)-7-fluoro-1-methylquinolin-2-one.
Molecular Properties
| Compound Name | 3-(5,7-dimethoxy-2-oxochromen-3-yl)-7-fluoro-1-methylquinolin-2-one |
| PubChem CID | 177425154 |
| Molecular Formula | C21H16FNO5 |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 3-(5,7-dimethoxy-2-oxochromen-3-yl)-7-fluoro-1-methylquinolin-2-one |
| SMILES | COc1cc(OC)c2cc(-c3cc4ccc(F)cc4n(C)c3=O)c(=O)oc2c1 |
| InChI | InChI=1S/C21H16FNO5/c1-23-17-7-12(22)5-4-11(17)6-14(20(23)24)15-10-16-18(27-3)8-13(26-2)9-19(16)28-21(15)25/h4-10H,1-3H3 |
| InChIKey | YDIKRJCDURUDMQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 70.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-(5,7-dimethoxy-2-oxochromen-3-yl)-7-fluoro-1-methylquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5,7-dimethoxy-2-oxochromen-3-yl)-7-fluoro-1-methylquinolin-2-one?
The IUPAC name of 3-(5,7-dimethoxy-2-oxochromen-3-yl)-7-fluoro-1-methylquinolin-2-one (CID 177425154) is 3-(5,7-dimethoxy-2-oxochromen-3-yl)-7-fluoro-1-methylquinolin-2-one.
What is the SMILES notation for 3-(5,7-dimethoxy-2-oxochromen-3-yl)-7-fluoro-1-methylquinolin-2-one?
The canonical SMILES for 3-(5,7-dimethoxy-2-oxochromen-3-yl)-7-fluoro-1-methylquinolin-2-one is COc1cc(OC)c2cc(-c3cc4ccc(F)cc4n(C)c3=O)c(=O)oc2c1.
What is the InChIKey of 3-(5,7-dimethoxy-2-oxochromen-3-yl)-7-fluoro-1-methylquinolin-2-one?
The InChIKey is YDIKRJCDURUDMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16FNO5/c1-23-17-7-12(22)5-4-11(17)6-14(20(23)24)15-10-16-18(27-3)8-13(26-2)9-19(16)28-21(15)25/h4-10H,1-3H3.
What are the key properties of 3-(5,7-dimethoxy-2-oxochromen-3-yl)-7-fluoro-1-methylquinolin-2-one?
3-(5,7-dimethoxy-2-oxochromen-3-yl)-7-fluoro-1-methylquinolin-2-one has a molecular weight of 381.36 g/mol, XLogP of 3.47, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5,7-dimethoxy-2-oxochromen-3-yl)-7-fluoro-1-methylquinolin-2-one is sourced from PubChem (CID 177425154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).