About bis[bis(trimethylsilyl)amino]germylideneplatinum;bis(triethylphosphanium)
bis[bis(trimethylsilyl)amino]germylideneplatinum;bis(triethylphosphanium) (PubChem CID 177426240) has the molecular formula C24H68GeN2P2PtSi4+2
and a molecular weight of 826.80 g/mol. Its IUPAC name is bis[bis(trimethylsilyl)amino]germylideneplatinum;bis(triethylphosphanium).
Molecular Properties
| Compound Name | bis[bis(trimethylsilyl)amino]germylideneplatinum;bis(triethylphosphanium) |
| PubChem CID | 177426240 |
| Molecular Formula | C24H68GeN2P2PtSi4+2 |
| Molecular Weight | 826.80 g/mol |
| Exact Mass | 827.28 |
| IUPAC Name | bis[bis(trimethylsilyl)amino]germylideneplatinum;bis(triethylphosphanium) |
| SMILES | CC[PH+](CC)CC.CC[PH+](CC)CC.C[Si](C)(C)N([Ge](=[Pt])N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C12H36GeN2Si4.2C6H15P.Pt/c1-16(2,3)14(17(4,5)6)13-15(18(7,8)9)19(10,11)12;2*1-4-7(5-2)6-3;/h1-12H3;2*4-6H2,1-3H3;/p+2 |
| InChIKey | DLXDFYFTQNOOQN-UHFFFAOYSA-P |
| XLogP | 8.98 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 826.80 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis[bis(trimethylsilyl)amino]germylideneplatinum;bis(triethylphosphanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[bis(trimethylsilyl)amino]germylideneplatinum;bis(triethylphosphanium)?
The IUPAC name of bis[bis(trimethylsilyl)amino]germylideneplatinum;bis(triethylphosphanium) (CID 177426240) is bis[bis(trimethylsilyl)amino]germylideneplatinum;bis(triethylphosphanium).
What is the SMILES notation for bis[bis(trimethylsilyl)amino]germylideneplatinum;bis(triethylphosphanium)?
The canonical SMILES for bis[bis(trimethylsilyl)amino]germylideneplatinum;bis(triethylphosphanium) is CC[PH+](CC)CC.CC[PH+](CC)CC.C[Si](C)(C)N([Ge](=[Pt])N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C.
What is the InChIKey of bis[bis(trimethylsilyl)amino]germylideneplatinum;bis(triethylphosphanium)?
The InChIKey is DLXDFYFTQNOOQN-UHFFFAOYSA-P. The full InChI is InChI=1S/C12H36GeN2Si4.2C6H15P.Pt/c1-16(2,3)14(17(4,5)6)13-15(18(7,8)9)19(10,11)12;2*1-4-7(5-2)6-3;/h1-12H3;2*4-6H2,1-3H3;/p+2.
What are the key properties of bis[bis(trimethylsilyl)amino]germylideneplatinum;bis(triethylphosphanium)?
bis[bis(trimethylsilyl)amino]germylideneplatinum;bis(triethylphosphanium) has a molecular weight of 826.80 g/mol, XLogP of 8.98, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis[bis(trimethylsilyl)amino]germylideneplatinum;bis(triethylphosphanium) is sourced from PubChem (CID 177426240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).