C39H29F3N2O2S — CID 177426412
15-(4-methylphenyl)sulfonyl-11-phenyl-13-[4-(trifluoromethyl)phenyl]-12,15-diazapentacyclo[10.9.0.02,9.03,8.016,21]henicosa-3,5,7,10,13,16,18,20-octaene (PubChem CID 177426412) has the molecular formula C39H29F3N2O2S and a molecular weight of 646.73 g/mol. Its IUPAC name is 15-(4-methylphenyl)sulfonyl-11-phenyl-13-[4-(trifluoromethyl)phenyl]-12,15-diazapentacyclo[10.9.0.02,9.03,8.016,21]henicosa-3,5,7,10,13,16,18,20-octaene.
| Compound Name | 15-(4-methylphenyl)sulfonyl-11-phenyl-13-[4-(trifluoromethyl)phenyl]-12,15-diazapentacyclo[10.9.0.02,9.03,8.016,21]henicosa-3,5,7,10,13,16,18,20-octaene |
|---|---|
| PubChem CID | 177426412 |
| Molecular Formula | C39H29F3N2O2S |
| Molecular Weight | 646.73 g/mol |
| Exact Mass | 646.19 |
| IUPAC Name | 15-(4-methylphenyl)sulfonyl-11-phenyl-13-[4-(trifluoromethyl)phenyl]-12,15-diazapentacyclo[10.9.0.02,9.03,8.016,21]henicosa-3,5,7,10,13,16,18,20-octaene |
| SMILES | Cc1ccc(S(=O)(=O)N2C=C(c3ccc(C(F)(F)F)cc3)N3C(c4ccccc4)=CC4c5ccccc5C4C3c3ccccc32)cc1 |
| InChI | InChI=1S/C39H29F3N2O2S/c1-25-15-21-29(22-16-25)47(45,46)43-24-36(27-17-19-28(20-18-27)39(40,41)42)44-35(26-9-3-2-4-10-26)23-33-30-11-5-6-12-31(30)37(33)38(44)32-13-7-8-14-34(32)43/h2-24,33,37-38H,1H3 |
| InChIKey | VADQXVBHQOIIQH-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.73 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |