C22H18N4O — CID 177426418
(14Z,19Z)-10,10-dimethyl-21,22-dihydroporphyrin-5-one (PubChem CID 177426418) has the molecular formula C22H18N4O and a molecular weight of 354.41 g/mol. Its IUPAC name is (14Z,19Z)-10,10-dimethyl-21,22-dihydroporphyrin-5-one.
| Compound Name | (14Z,19Z)-10,10-dimethyl-21,22-dihydroporphyrin-5-one |
|---|---|
| PubChem CID | 177426418 |
| Molecular Formula | C22H18N4O |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (14Z,19Z)-10,10-dimethyl-21,22-dihydroporphyrin-5-one |
| SMILES | CC1(C)C2=N/C(=C\C3=N/C(=C\c4ccc([nH]4)C(=O)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C22H18N4O/c1-22(2)19-9-6-16(25-19)12-14-4-3-13(23-14)11-15-5-7-17(24-15)21(27)18-8-10-20(22)26-18/h3-12,24,26H,1-2H3/b13-11-,16-12- |
| InChIKey | SLXXEDPLGCHKGR-KZWIATNNSA-N |
| XLogP | 4.11 |
| TPSA | 73.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |