C34H32I2O4 — CID 177426544
3-(4-iodophenyl)-6-[4-[4-(4-iodophenyl)-1,4-dimethoxycyclohexa-2,5-dien-1-yl]phenyl]-3,6-dimethoxycyclohexa-1,4-diene (PubChem CID 177426544) has the molecular formula C34H32I2O4 and a molecular weight of 758.43 g/mol. Its IUPAC name is 3-(4-iodophenyl)-6-[4-[4-(4-iodophenyl)-1,4-dimethoxycyclohexa-2,5-dien-1-yl]phenyl]-3,6-dimethoxycyclohexa-1,4-diene.
| Compound Name | 3-(4-iodophenyl)-6-[4-[4-(4-iodophenyl)-1,4-dimethoxycyclohexa-2,5-dien-1-yl]phenyl]-3,6-dimethoxycyclohexa-1,4-diene |
|---|---|
| PubChem CID | 177426544 |
| Molecular Formula | C34H32I2O4 |
| Molecular Weight | 758.43 g/mol |
| Exact Mass | 758.04 |
| IUPAC Name | 3-(4-iodophenyl)-6-[4-[4-(4-iodophenyl)-1,4-dimethoxycyclohexa-2,5-dien-1-yl]phenyl]-3,6-dimethoxycyclohexa-1,4-diene |
| SMILES | COC1(c2ccc(I)cc2)C=CC(OC)(c2ccc(C3(OC)C=CC(OC)(c4ccc(I)cc4)C=C3)cc2)C=C1 |
| InChI | InChI=1S/C34H32I2O4/c1-37-31(17-21-33(39-3,22-18-31)27-9-13-29(35)14-10-27)25-5-7-26(8-6-25)32(38-2)19-23-34(40-4,24-20-32)28-11-15-30(36)16-12-28/h5-24H,1-4H3 |
| InChIKey | ZIJOHJMDZCUTSL-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.43 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|