About (Z)-1,3-difluoroprop-1-en-2-ol
(Z)-1,3-difluoroprop-1-en-2-ol (PubChem CID 177426910) has the molecular formula C3H3F2O+
and a molecular weight of 93.05 g/mol. Its IUPAC name is (Z)-1,3-difluoroprop-1-en-2-ol.
Molecular Properties
| Compound Name | (Z)-1,3-difluoroprop-1-en-2-ol |
| PubChem CID | 177426910 |
| Molecular Formula | C3H3F2O+ |
| Molecular Weight | 93.05 g/mol |
| Exact Mass | 93.01 |
| IUPAC Name | (Z)-1,3-difluoroprop-1-en-2-ol |
| SMILES | O/C(=C\F)[CH+]F |
| InChI | InChI=1S/C3H2F2O/c4-1-3(6)2-5/h1-2H/p+1/b3-1- |
| InChIKey | GURXKFFNROIRRR-IWQZZHSRSA-O |
| XLogP | 1.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 93.05 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1,3-difluoroprop-1-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1,3-difluoroprop-1-en-2-ol?
The IUPAC name of (Z)-1,3-difluoroprop-1-en-2-ol (CID 177426910) is (Z)-1,3-difluoroprop-1-en-2-ol.
What is the SMILES notation for (Z)-1,3-difluoroprop-1-en-2-ol?
The canonical SMILES for (Z)-1,3-difluoroprop-1-en-2-ol is O/C(=C\F)[CH+]F.
What is the InChIKey of (Z)-1,3-difluoroprop-1-en-2-ol?
The InChIKey is GURXKFFNROIRRR-IWQZZHSRSA-O. The full InChI is InChI=1S/C3H2F2O/c4-1-3(6)2-5/h1-2H/p+1/b3-1-.
What are the key properties of (Z)-1,3-difluoroprop-1-en-2-ol?
(Z)-1,3-difluoroprop-1-en-2-ol has a molecular weight of 93.05 g/mol, XLogP of 1.49, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1,3-difluoroprop-1-en-2-ol is sourced from PubChem (CID 177426910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).