About CID 177426937
CID 177426937 (PubChem CID 177426937) has the molecular formula C33H27N3O4
and a molecular weight of 529.60 g/mol.
Molecular Properties
| Compound Name | CID 177426937 |
| PubChem CID | 177426937 |
| Molecular Formula | C33H27N3O4 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | — |
| SMILES | N#Cc1ccc(OC(=O)CN2c3ccccc3C3(OOC34C3CC5CC(C3)CC4C5)c3ccccc32)cc1C#N |
| InChI | InChI=1S/C33H27N3O4/c34-17-22-9-10-26(16-23(22)18-35)38-31(37)19-36-29-7-3-1-5-27(29)33(28-6-2-4-8-30(28)36)32(39-40-33)24-12-20-11-21(14-24)15-25(32)13-20/h1-10,16,20-21,24-25H,11-15,19H2 |
| InChIKey | DWSCUENDIKQBQO-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 95.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze CID 177426937 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177426937?
The IUPAC name of CID 177426937 (CID 177426937) is not available.
What is the SMILES notation for CID 177426937?
The canonical SMILES for CID 177426937 is N#Cc1ccc(OC(=O)CN2c3ccccc3C3(OOC34C3CC5CC(C3)CC4C5)c3ccccc32)cc1C#N.
What is the InChIKey of CID 177426937?
The InChIKey is DWSCUENDIKQBQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H27N3O4/c34-17-22-9-10-26(16-23(22)18-35)38-31(37)19-36-29-7-3-1-5-27(29)33(28-6-2-4-8-30(28)36)32(39-40-33)24-12-20-11-21(14-24)15-25(32)13-20/h1-10,16,20-21,24-25H,11-15,19H2.
What are the key properties of CID 177426937?
CID 177426937 has a molecular weight of 529.60 g/mol, XLogP of 5.89, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177426937 is sourced from PubChem (CID 177426937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).