C27H35N3O3S — CID 177427065
(1S,2S,6S,7S,11R)-4-[(Z)-[3-(4-methoxyphenyl)-1,3-thiazepan-2-ylidene]amino]-1,9-dimethyl-11-propan-2-yl-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione (PubChem CID 177427065) has the molecular formula C27H35N3O3S and a molecular weight of 481.66 g/mol. Its IUPAC name is (1S,2S,6S,7S,11R)-4-[(Z)-[3-(4-methoxyphenyl)-1,3-thiazepan-2-ylidene]amino]-1,9-dimethyl-11-propan-2-yl-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione.
| Compound Name | (1S,2S,6S,7S,11R)-4-[(Z)-[3-(4-methoxyphenyl)-1,3-thiazepan-2-ylidene]amino]-1,9-dimethyl-11-propan-2-yl-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 177427065 |
| Molecular Formula | C27H35N3O3S |
| Molecular Weight | 481.66 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | (1S,2S,6S,7S,11R)-4-[(Z)-[3-(4-methoxyphenyl)-1,3-thiazepan-2-ylidene]amino]-1,9-dimethyl-11-propan-2-yl-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
| SMILES | COc1ccc(N2CCCCS/C2=N\N2C(=O)[C@H]3[C@@H]4C=C(C)[C@@](C)(C[C@@H]4C(C)C)[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C27H35N3O3S/c1-16(2)21-15-27(4)17(3)14-20(21)22-23(27)25(32)30(24(22)31)28-26-29(12-6-7-13-34-26)18-8-10-19(33-5)11-9-18/h8-11,14,16,20-23H,6-7,12-13,15H2,1-5H3/b28-26-/t20-,21-,22+,23-,27-/m1/s1 |
| InChIKey | SZRBXCXXYLRAOM-CBVBWNOBSA-N |
| XLogP | 5.16 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.66 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|