About [(E)-4-[(3R)-2,2-dimethyl-5-oxooxolan-3-yl]butan-2-ylideneamino]urea
[(E)-4-[(3R)-2,2-dimethyl-5-oxooxolan-3-yl]butan-2-ylideneamino]urea (PubChem CID 177427437) has the molecular formula C11H19N3O3
and a molecular weight of 241.29 g/mol. Its IUPAC name is [(E)-4-[(3R)-2,2-dimethyl-5-oxooxolan-3-yl]butan-2-ylideneamino]urea.
Molecular Properties
| Compound Name | [(E)-4-[(3R)-2,2-dimethyl-5-oxooxolan-3-yl]butan-2-ylideneamino]urea |
| PubChem CID | 177427437 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | [(E)-4-[(3R)-2,2-dimethyl-5-oxooxolan-3-yl]butan-2-ylideneamino]urea |
| SMILES | C/C(CC[C@@H]1CC(=O)OC1(C)C)=N\NC(N)=O |
| InChI | InChI=1S/C11H19N3O3/c1-7(13-14-10(12)16)4-5-8-6-9(15)17-11(8,2)3/h8H,4-6H2,1-3H3,(H3,12,14,16)/b13-7+/t8-/m1/s1 |
| InChIKey | HBBZTNDXYIEDLA-OREIZAMCSA-N |
| XLogP | 1.15 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-4-[(3R)-2,2-dimethyl-5-oxooxolan-3-yl]butan-2-ylideneamino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-4-[(3R)-2,2-dimethyl-5-oxooxolan-3-yl]butan-2-ylideneamino]urea?
The IUPAC name of [(E)-4-[(3R)-2,2-dimethyl-5-oxooxolan-3-yl]butan-2-ylideneamino]urea (CID 177427437) is [(E)-4-[(3R)-2,2-dimethyl-5-oxooxolan-3-yl]butan-2-ylideneamino]urea.
What is the SMILES notation for [(E)-4-[(3R)-2,2-dimethyl-5-oxooxolan-3-yl]butan-2-ylideneamino]urea?
The canonical SMILES for [(E)-4-[(3R)-2,2-dimethyl-5-oxooxolan-3-yl]butan-2-ylideneamino]urea is C/C(CC[C@@H]1CC(=O)OC1(C)C)=N\NC(N)=O.
What is the InChIKey of [(E)-4-[(3R)-2,2-dimethyl-5-oxooxolan-3-yl]butan-2-ylideneamino]urea?
The InChIKey is HBBZTNDXYIEDLA-OREIZAMCSA-N. The full InChI is InChI=1S/C11H19N3O3/c1-7(13-14-10(12)16)4-5-8-6-9(15)17-11(8,2)3/h8H,4-6H2,1-3H3,(H3,12,14,16)/b13-7+/t8-/m1/s1.
What are the key properties of [(E)-4-[(3R)-2,2-dimethyl-5-oxooxolan-3-yl]butan-2-ylideneamino]urea?
[(E)-4-[(3R)-2,2-dimethyl-5-oxooxolan-3-yl]butan-2-ylideneamino]urea has a molecular weight of 241.29 g/mol, XLogP of 1.15, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-4-[(3R)-2,2-dimethyl-5-oxooxolan-3-yl]butan-2-ylideneamino]urea is sourced from PubChem (CID 177427437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).