C29H54O4S2Sn — CID 177428143
(2R)-4-(2-methyl-1,3-dithiolan-2-yl)-2-[(4R,5R,6R)-2,2,5-trimethyl-6-[(E)-2-tributylstannylethenyl]-1,3-dioxan-4-yl]butanoic acid (PubChem CID 177428143) has the molecular formula C29H54O4S2Sn and a molecular weight of 649.59 g/mol. Its IUPAC name is (2R)-4-(2-methyl-1,3-dithiolan-2-yl)-2-[(4R,5R,6R)-2,2,5-trimethyl-6-[(E)-2-tributylstannylethenyl]-1,3-dioxan-4-yl]butanoic acid.
| Compound Name | (2R)-4-(2-methyl-1,3-dithiolan-2-yl)-2-[(4R,5R,6R)-2,2,5-trimethyl-6-[(E)-2-tributylstannylethenyl]-1,3-dioxan-4-yl]butanoic acid |
|---|---|
| PubChem CID | 177428143 |
| Molecular Formula | C29H54O4S2Sn |
| Molecular Weight | 649.59 g/mol |
| Exact Mass | 650.25 |
| IUPAC Name | (2R)-4-(2-methyl-1,3-dithiolan-2-yl)-2-[(4R,5R,6R)-2,2,5-trimethyl-6-[(E)-2-tributylstannylethenyl]-1,3-dioxan-4-yl]butanoic acid |
| SMILES | CCCC[Sn](/C=C/[C@@H]1OC(C)(C)O[C@@H]([C@@H](CCC2(C)SCCS2)C(=O)O)[C@H]1C)(CCCC)CCCC |
| InChI | InChI=1S/C17H27O4S2.3C4H9.Sn/c1-6-13-11(2)14(21-16(3,4)20-13)12(15(18)19)7-8-17(5)22-9-10-23-17;3*1-3-4-2;/h1,6,11-14H,7-10H2,2-5H3,(H,18,19);3*1,3-4H2,2H3;/t11-,12+,13-,14+;;;;/m0..../s1 |
| InChIKey | FELZPVJDPOGFLN-JBLKBCCSSA-N |
| XLogP | 8.76 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.59 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |