C14H8Cl2N4O3 — CID 177428539
8-(2,4-dichlorophenyl)-2-oxa-4,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3(7),5-triene-10,12-dione (PubChem CID 177428539) has the molecular formula C14H8Cl2N4O3 and a molecular weight of 351.15 g/mol. Its IUPAC name is 8-(2,4-dichlorophenyl)-2-oxa-4,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3(7),5-triene-10,12-dione.
| Compound Name | 8-(2,4-dichlorophenyl)-2-oxa-4,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3(7),5-triene-10,12-dione |
|---|---|
| PubChem CID | 177428539 |
| Molecular Formula | C14H8Cl2N4O3 |
| Molecular Weight | 351.15 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 8-(2,4-dichlorophenyl)-2-oxa-4,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3(7),5-triene-10,12-dione |
| SMILES | O=c1[nH]c2c(c(=O)[nH]1)C(c1ccc(Cl)cc1Cl)c1cn[nH]c1O2 |
| InChI | InChI=1S/C14H8Cl2N4O3/c15-5-1-2-6(8(16)3-5)9-7-4-17-20-12(7)23-13-10(9)11(21)18-14(22)19-13/h1-4,9H,(H,17,20)(H2,18,19,21,22) |
| InChIKey | UZYWHIVPTPOWLE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 103.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.15 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |