About CID 177428581
CID 177428581 (PubChem CID 177428581) has the molecular formula C11H21Si
and a molecular weight of 181.37 g/mol.
Molecular Properties
| Compound Name | CID 177428581 |
| PubChem CID | 177428581 |
| Molecular Formula | C11H21Si |
| Molecular Weight | 181.37 g/mol |
| Exact Mass | 181.14 |
| IUPAC Name | — |
| SMILES | C=C=C(CCCCCC)[Si](C)C |
| InChI | InChI=1S/C11H21Si/c1-5-7-8-9-10-11(6-2)12(3)4/h2,5,7-10H2,1,3-4H3 |
| InChIKey | IMXHNFVXSVXAGK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 177428581 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177428581?
The IUPAC name of CID 177428581 (CID 177428581) is not available.
What is the SMILES notation for CID 177428581?
The canonical SMILES for CID 177428581 is C=C=C(CCCCCC)[Si](C)C.
What is the InChIKey of CID 177428581?
The InChIKey is IMXHNFVXSVXAGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21Si/c1-5-7-8-9-10-11(6-2)12(3)4/h2,5,7-10H2,1,3-4H3.
What are the key properties of CID 177428581?
CID 177428581 has a molecular weight of 181.37 g/mol, XLogP of 3.96, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177428581 is sourced from PubChem (CID 177428581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).