C26H39N2+ — CID 177429719
(1R,2R,10Z,16S,23Z,27R)-18-aza-5-azoniapentacyclo[12.12.1.11,5.02,16.018,27]octacosa-5(28),10,14,23-tetraene (PubChem CID 177429719) has the molecular formula C26H39N2+ and a molecular weight of 379.61 g/mol. Its IUPAC name is (1R,2R,10Z,16S,23Z,27R)-18-aza-5-azoniapentacyclo[12.12.1.11,5.02,16.018,27]octacosa-5(28),10,14,23-tetraene.
| Compound Name | (1R,2R,10Z,16S,23Z,27R)-18-aza-5-azoniapentacyclo[12.12.1.11,5.02,16.018,27]octacosa-5(28),10,14,23-tetraene |
|---|---|
| PubChem CID | 177429719 |
| Molecular Formula | C26H39N2+ |
| Molecular Weight | 379.61 g/mol |
| Exact Mass | 379.31 |
| IUPAC Name | (1R,2R,10Z,16S,23Z,27R)-18-aza-5-azoniapentacyclo[12.12.1.11,5.02,16.018,27]octacosa-5(28),10,14,23-tetraene |
| SMILES | C1=C2CC/C=C\CCCC[N+]3=C[C@]45CC/C=C\CCCCN(C[C@@H]1[C@H]4CC3)[C@H]25 |
| InChI | InChI=1S/C26H39N2/c1-3-7-11-16-27-18-14-24-23-19-22(13-9-5-1)25-26(24,21-27)15-10-6-2-4-8-12-17-28(25)20-23/h1-2,5-6,19,21,23-25H,3-4,7-18,20H2/q+1/b5-1-,6-2-/t23-,24-,25-,26-/m1/s1 |
| InChIKey | QWCIIIVPHYLUHM-FJLUOUPYSA-N |
| XLogP | 5.36 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.61 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|