C26H23N3O3S2 — CID 177429811
(1'S,2'R,3'S,4'R,5'R,7'S,8'R,9'S,11'S,12'R)-15'-phenylspiro[1,3-dithiane-2,20'-13,15,17-triazaoctacyclo[10.5.2.12,8.02,11.03,7.04,11.05,9.013,17]icos-18-ene]-10',14',16'-trione (PubChem CID 177429811) has the molecular formula C26H23N3O3S2 and a molecular weight of 489.62 g/mol. Its IUPAC name is (1'S,2'R,3'S,4'R,5'R,7'S,8'R,9'S,11'S,12'R)-15'-phenylspiro[1,3-dithiane-2,20'-13,15,17-triazaoctacyclo[10.5.2.12,8.02,11.03,7.04,11.05,9.013,17]icos-18-ene]-10',14',16'-trione.
| Compound Name | (1'S,2'R,3'S,4'R,5'R,7'S,8'R,9'S,11'S,12'R)-15'-phenylspiro[1,3-dithiane-2,20'-13,15,17-triazaoctacyclo[10.5.2.12,8.02,11.03,7.04,11.05,9.013,17]icos-18-ene]-10',14',16'-trione |
|---|---|
| PubChem CID | 177429811 |
| Molecular Formula | C26H23N3O3S2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | (1'S,2'R,3'S,4'R,5'R,7'S,8'R,9'S,11'S,12'R)-15'-phenylspiro[1,3-dithiane-2,20'-13,15,17-triazaoctacyclo[10.5.2.12,8.02,11.03,7.04,11.05,9.013,17]icos-18-ene]-10',14',16'-trione |
| SMILES | O=C1[C@H]2[C@@H]3C[C@@H]4[C@H]2C2(SCCCS2)[C@]25[C@@H]4[C@@H]3[C@]12[C@H]1C=C[C@@H]5n2c(=O)n(-c3ccccc3)c(=O)n21 |
| InChI | InChI=1S/C26H23N3O3S2/c30-21-17-13-11-14-18(17)26(33-9-4-10-34-26)25-16-8-7-15(24(21,25)19(13)20(14)25)28-22(31)27(23(32)29(16)28)12-5-2-1-3-6-12/h1-3,5-8,13-20H,4,9-11H2/t13-,14+,15+,16-,17-,18+,19+,20-,24+,25+/m0/s1 |
| InChIKey | PTDZONVQBPNEPP-NFCRFBRQSA-N |
| XLogP | 2.73 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|