C44H31F2N2OP — CID 177430540
[(4R,5R)-2-[2-bis(4-fluorophenyl)phosphanylphenyl]-4,5-diphenyl-4,5-dihydroimidazol-1-yl]-naphthalen-2-ylmethanone (PubChem CID 177430540) has the molecular formula C44H31F2N2OP and a molecular weight of 672.72 g/mol. Its IUPAC name is [(4R,5R)-2-[2-bis(4-fluorophenyl)phosphanylphenyl]-4,5-diphenyl-4,5-dihydroimidazol-1-yl]-naphthalen-2-ylmethanone.
| Compound Name | [(4R,5R)-2-[2-bis(4-fluorophenyl)phosphanylphenyl]-4,5-diphenyl-4,5-dihydroimidazol-1-yl]-naphthalen-2-ylmethanone |
|---|---|
| PubChem CID | 177430540 |
| Molecular Formula | C44H31F2N2OP |
| Molecular Weight | 672.72 g/mol |
| Exact Mass | 672.21 |
| IUPAC Name | [(4R,5R)-2-[2-bis(4-fluorophenyl)phosphanylphenyl]-4,5-diphenyl-4,5-dihydroimidazol-1-yl]-naphthalen-2-ylmethanone |
| SMILES | O=C(c1ccc2ccccc2c1)N1C(c2ccccc2P(c2ccc(F)cc2)c2ccc(F)cc2)=N[C@H](c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C44H31F2N2OP/c45-35-21-25-37(26-22-35)50(38-27-23-36(46)24-28-38)40-18-10-9-17-39(40)43-47-41(31-12-3-1-4-13-31)42(32-14-5-2-6-15-32)48(43)44(49)34-20-19-30-11-7-8-16-33(30)29-34/h1-29,41-42H/t41-,42-/m1/s1 |
| InChIKey | SMSCOISKFQKUTA-NCRNUEESSA-N |
| XLogP | 9.26 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.72 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|