C8H10O — CID 177430855
1,1,2-trideuterio-2-(2,3,4,5,6-pentadeuteriophenyl)ethanol (PubChem CID 177430855) has the molecular formula C8H10O and a molecular weight of 130.22 g/mol. Its IUPAC name is 1,1,2-trideuterio-2-(2,3,4,5,6-pentadeuteriophenyl)ethanol.
| Compound Name | 1,1,2-trideuterio-2-(2,3,4,5,6-pentadeuteriophenyl)ethanol |
|---|---|
| PubChem CID | 177430855 |
| Molecular Formula | C8H10O |
| Molecular Weight | 130.22 g/mol |
| Exact Mass | 130.12 |
| IUPAC Name | 1,1,2-trideuterio-2-(2,3,4,5,6-pentadeuteriophenyl)ethanol |
| SMILES | [2H]c1c([2H])c([2H])c(C([2H])C([2H])([2H])O)c([2H])c1[2H] |
| InChI | InChI=1S/C8H10O/c9-7-6-8-4-2-1-3-5-8/h1-5,9H,6-7H2/i1D,2D,3D,4D,5D,6D,7D2 |
| InChIKey | WRMNZCZEMHIOCP-KYMWXIBHSA-N |
| XLogP | 1.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.22 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |