C32H56N2O — CID 177431449
(12R,14R,21Z,29R,30R)-1,16-diazatetracyclo[27.3.1.112,16.014,30]tetratriacont-21-en-34-one (PubChem CID 177431449) has the molecular formula C32H56N2O and a molecular weight of 484.81 g/mol. Its IUPAC name is (12R,14R,21Z,29R,30R)-1,16-diazatetracyclo[27.3.1.112,16.014,30]tetratriacont-21-en-34-one.
| Compound Name | (12R,14R,21Z,29R,30R)-1,16-diazatetracyclo[27.3.1.112,16.014,30]tetratriacont-21-en-34-one |
|---|---|
| PubChem CID | 177431449 |
| Molecular Formula | C32H56N2O |
| Molecular Weight | 484.81 g/mol |
| Exact Mass | 484.44 |
| IUPAC Name | (12R,14R,21Z,29R,30R)-1,16-diazatetracyclo[27.3.1.112,16.014,30]tetratriacont-21-en-34-one |
| SMILES | O=C1[C@@H]2CCCCCCCCCCN3CC[C@@H]4[C@@H](CCCCCC/C=C\CCCCN1C[C@@H]4C2)C3 |
| InChI | InChI=1S/C32H56N2O/c35-32-28-19-15-11-7-4-6-9-13-17-22-33-24-21-31-29(26-33)20-16-12-8-3-1-2-5-10-14-18-23-34(32)27-30(31)25-28/h2,5,28-31H,1,3-4,6-27H2/b5-2-/t28-,29+,30+,31-/m1/s1 |
| InChIKey | CWFVEJPWNTZZFC-MXCHZMRJSA-N |
| XLogP | 7.99 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.81 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|