About CID 177431719
CID 177431719 (PubChem CID 177431719) has the molecular formula C4H5N2O2S
and a molecular weight of 145.16 g/mol.
Molecular Properties
| Compound Name | CID 177431719 |
| PubChem CID | 177431719 |
| Molecular Formula | C4H5N2O2S |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.01 |
| IUPAC Name | — |
| SMILES | O=C1[CH]C(O)NC(=S)N1 |
| InChI | InChI=1S/C4H5N2O2S/c7-2-1-3(8)6-4(9)5-2/h1-2,7H,(H2,5,6,8,9) |
| InChIKey | AQZWQXZYQSWNTA-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze CID 177431719 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177431719?
The IUPAC name of CID 177431719 (CID 177431719) is not available.
What is the SMILES notation for CID 177431719?
The canonical SMILES for CID 177431719 is O=C1[CH]C(O)NC(=S)N1.
What is the InChIKey of CID 177431719?
The InChIKey is AQZWQXZYQSWNTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N2O2S/c7-2-1-3(8)6-4(9)5-2/h1-2,7H,(H2,5,6,8,9).
What are the key properties of CID 177431719?
CID 177431719 has a molecular weight of 145.16 g/mol, XLogP of -1.49, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177431719 is sourced from PubChem (CID 177431719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).