C27H30N3O4+ — CID 177431771
[11,17-bis(dimethylamino)-3,19-dimethoxy-8,14-dioxapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-1,3,6,9,11,13(21),15(20),16,18-nonaen-5-ylidene]-dimethylazanium (PubChem CID 177431771) has the molecular formula C27H30N3O4+ and a molecular weight of 460.55 g/mol. Its IUPAC name is [11,17-bis(dimethylamino)-3,19-dimethoxy-8,14-dioxapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-1,3,6,9,11,13(21),15(20),16,18-nonaen-5-ylidene]-dimethylazanium.
| Compound Name | [11,17-bis(dimethylamino)-3,19-dimethoxy-8,14-dioxapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-1,3,6,9,11,13(21),15(20),16,18-nonaen-5-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 177431771 |
| Molecular Formula | C27H30N3O4+ |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | [11,17-bis(dimethylamino)-3,19-dimethoxy-8,14-dioxapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-1,3,6,9,11,13(21),15(20),16,18-nonaen-5-ylidene]-dimethylazanium |
| SMILES | COc1cc(N(C)C)cc2oc3cc(N(C)C)cc4oc5cc(=[N+](C)C)cc(OC)c5c(c12)c34 |
| InChI | InChI=1S/C27H30N3O4/c1-28(2)15-9-18(31-7)24-20(11-15)33-22-13-17(30(5)6)14-23-26(22)27(24)25-19(32-8)10-16(29(3)4)12-21(25)34-23/h9-14H,1-8H3/q+1 |
| InChIKey | CWHGGGWGFYQPFN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 54.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|