C20H31LiO7 — CID 177432135
lithium 2-(phenylmethoxymethyl)-1,4,7,10,13,16-hexaoxacyclooctadecane (PubChem CID 177432135) has the molecular formula C20H31LiO7 and a molecular weight of 390.40 g/mol. Its IUPAC name is lithium 2-(phenylmethoxymethyl)-1,4,7,10,13,16-hexaoxacyclooctadecane.
| Compound Name | lithium 2-(phenylmethoxymethyl)-1,4,7,10,13,16-hexaoxacyclooctadecane |
|---|---|
| PubChem CID | 177432135 |
| Molecular Formula | C20H31LiO7 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | lithium 2-(phenylmethoxymethyl)-1,4,7,10,13,16-hexaoxacyclooctadecane |
| SMILES | [Li+].c1ccc([CH-]OCC2COCCOCCOCCOCCOCCO2)cc1 |
| InChI | InChI=1S/C20H31O7.Li/c1-2-4-19(5-3-1)16-26-18-20-17-25-13-12-23-9-8-21-6-7-22-10-11-24-14-15-27-20;/h1-5,16,20H,6-15,17-18H2;/q-1;+1 |
| InChIKey | GDOZPPBGVZLJPO-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|