C12H18O6S2 — CID 177432516
(1R,4S,5R,8S,9R,10R)-4,8-dihydroxy-9-methyl-10-(propyldisulfanyl)-2,6,11-trioxatricyclo[6.3.0.01,5]undecan-7-one (PubChem CID 177432516) has the molecular formula C12H18O6S2 and a molecular weight of 322.40 g/mol. Its IUPAC name is (1R,4S,5R,8S,9R,10R)-4,8-dihydroxy-9-methyl-10-(propyldisulfanyl)-2,6,11-trioxatricyclo[6.3.0.01,5]undecan-7-one.
| Compound Name | (1R,4S,5R,8S,9R,10R)-4,8-dihydroxy-9-methyl-10-(propyldisulfanyl)-2,6,11-trioxatricyclo[6.3.0.01,5]undecan-7-one |
|---|---|
| PubChem CID | 177432516 |
| Molecular Formula | C12H18O6S2 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | (1R,4S,5R,8S,9R,10R)-4,8-dihydroxy-9-methyl-10-(propyldisulfanyl)-2,6,11-trioxatricyclo[6.3.0.01,5]undecan-7-one |
| SMILES | CCCSS[C@H]1O[C@]23OC[C@H](O)[C@H]2OC(=O)[C@]3(O)[C@H]1C |
| InChI | InChI=1S/C12H18O6S2/c1-3-4-19-20-9-6(2)11(15)10(14)17-8-7(13)5-16-12(8,11)18-9/h6-9,13,15H,3-5H2,1-2H3/t6-,7-,8+,9+,11+,12+/m0/s1 |
| InChIKey | USSAFJYCTPPQHB-YWTHNDQWSA-N |
| XLogP | 0.51 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|