C10H16O5 — CID 177433119
ethyl (1R,2S,5S)-1,5-dimethyl-6,7,8-trioxabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 177433119) has the molecular formula C10H16O5 and a molecular weight of 216.23 g/mol. Its IUPAC name is ethyl (1R,2S,5S)-1,5-dimethyl-6,7,8-trioxabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | ethyl (1R,2S,5S)-1,5-dimethyl-6,7,8-trioxabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 177433119 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | ethyl (1R,2S,5S)-1,5-dimethyl-6,7,8-trioxabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1CC[C@]2(C)OO[C@@]1(C)O2 |
| InChI | InChI=1S/C10H16O5/c1-4-12-8(11)7-5-6-9(2)13-10(7,3)15-14-9/h7H,4-6H2,1-3H3/t7-,9+,10-/m1/s1 |
| InChIKey | JOOQKTZPPJJERC-FKTZTGRPSA-N |
| XLogP | 1.37 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|