C29H54O5Si2 — CID 177433294
methyl (2E,4Z)-7-[tert-butyl(dimethyl)silyl]oxy-8-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,6-dihydro-2H-pyran-6-yl]-4-methylocta-2,4-dienoate (PubChem CID 177433294) has the molecular formula C29H54O5Si2 and a molecular weight of 538.92 g/mol. Its IUPAC name is methyl (2E,4Z)-7-[tert-butyl(dimethyl)silyl]oxy-8-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,6-dihydro-2H-pyran-6-yl]-4-methylocta-2,4-dienoate.
| Compound Name | methyl (2E,4Z)-7-[tert-butyl(dimethyl)silyl]oxy-8-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,6-dihydro-2H-pyran-6-yl]-4-methylocta-2,4-dienoate |
|---|---|
| PubChem CID | 177433294 |
| Molecular Formula | C29H54O5Si2 |
| Molecular Weight | 538.92 g/mol |
| Exact Mass | 538.35 |
| IUPAC Name | methyl (2E,4Z)-7-[tert-butyl(dimethyl)silyl]oxy-8-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,6-dihydro-2H-pyran-6-yl]-4-methylocta-2,4-dienoate |
| SMILES | COC(=O)/C=C/C(C)=C\CC(CC1C=CCC(CCO[Si](C)(C)C(C)(C)C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H54O5Si2/c1-23(17-19-27(30)31-8)16-18-26(34-36(11,12)29(5,6)7)22-25-15-13-14-24(33-25)20-21-32-35(9,10)28(2,3)4/h13,15-17,19,24-26H,14,18,20-22H2,1-12H3/b19-17+,23-16- |
| InChIKey | CIZDYKXVSCINQV-UGQQBUINSA-N |
| XLogP | 7.96 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.92 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|