C20H20N2O5S — CID 177433578
(3R,5E)-5-benzylidene-3-methyl-1-(2-nitrophenyl)sulfonylazepan-4-one (PubChem CID 177433578) has the molecular formula C20H20N2O5S and a molecular weight of 400.46 g/mol. Its IUPAC name is (3R,5E)-5-benzylidene-3-methyl-1-(2-nitrophenyl)sulfonylazepan-4-one.
| Compound Name | (3R,5E)-5-benzylidene-3-methyl-1-(2-nitrophenyl)sulfonylazepan-4-one |
|---|---|
| PubChem CID | 177433578 |
| Molecular Formula | C20H20N2O5S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | (3R,5E)-5-benzylidene-3-methyl-1-(2-nitrophenyl)sulfonylazepan-4-one |
| SMILES | C[C@@H]1CN(S(=O)(=O)c2ccccc2[N+](=O)[O-])CC/C(=C\c2ccccc2)C1=O |
| InChI | InChI=1S/C20H20N2O5S/c1-15-14-21(28(26,27)19-10-6-5-9-18(19)22(24)25)12-11-17(20(15)23)13-16-7-3-2-4-8-16/h2-10,13,15H,11-12,14H2,1H3/b17-13+/t15-/m1/s1 |
| InChIKey | ZNVQNHWSFUBALQ-OVGFGYAMSA-N |
| XLogP | 3.28 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|