About (1S,5R)-3-fluoro-6,8-dioxabicyclo[3.2.1]octan-4-one
(1S,5R)-3-fluoro-6,8-dioxabicyclo[3.2.1]octan-4-one (PubChem CID 177433761) has the molecular formula C6H7FO3
and a molecular weight of 146.12 g/mol. Its IUPAC name is (1S,5R)-3-fluoro-6,8-dioxabicyclo[3.2.1]octan-4-one.
Analyze (1S,5R)-3-fluoro-6,8-dioxabicyclo[3.2.1]octan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5R)-3-fluoro-6,8-dioxabicyclo[3.2.1]octan-4-one?
The IUPAC name of (1S,5R)-3-fluoro-6,8-dioxabicyclo[3.2.1]octan-4-one (CID 177433761) is (1S,5R)-3-fluoro-6,8-dioxabicyclo[3.2.1]octan-4-one.
What is the SMILES notation for (1S,5R)-3-fluoro-6,8-dioxabicyclo[3.2.1]octan-4-one?
The canonical SMILES for (1S,5R)-3-fluoro-6,8-dioxabicyclo[3.2.1]octan-4-one is O=C1C(F)C[C@H]2CO[C@@H]1O2.
What is the InChIKey of (1S,5R)-3-fluoro-6,8-dioxabicyclo[3.2.1]octan-4-one?
The InChIKey is YUPLRXWPXDXWID-QERKPNDOSA-N. The full InChI is InChI=1S/C6H7FO3/c7-4-1-3-2-9-6(10-3)5(4)8/h3-4,6H,1-2H2/t3-,4?,6+/m0/s1.
What are the key properties of (1S,5R)-3-fluoro-6,8-dioxabicyclo[3.2.1]octan-4-one?
(1S,5R)-3-fluoro-6,8-dioxabicyclo[3.2.1]octan-4-one has a molecular weight of 146.12 g/mol, XLogP of 0.04, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5R)-3-fluoro-6,8-dioxabicyclo[3.2.1]octan-4-one is sourced from PubChem (CID 177433761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).