About 1-[(Z)-1,2-bis(trimethylsilyl)ethenyl]cyclohexan-1-ol
1-[(Z)-1,2-bis(trimethylsilyl)ethenyl]cyclohexan-1-ol (PubChem CID 177433924) has the molecular formula C14H30OSi2
and a molecular weight of 270.56 g/mol. Its IUPAC name is 1-[(Z)-1,2-bis(trimethylsilyl)ethenyl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 1-[(Z)-1,2-bis(trimethylsilyl)ethenyl]cyclohexan-1-ol |
| PubChem CID | 177433924 |
| Molecular Formula | C14H30OSi2 |
| Molecular Weight | 270.56 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 1-[(Z)-1,2-bis(trimethylsilyl)ethenyl]cyclohexan-1-ol |
| SMILES | C[Si](C)(C)/C=C(/C1(O)CCCCC1)[Si](C)(C)C |
| InChI | InChI=1S/C14H30OSi2/c1-16(2,3)12-13(17(4,5)6)14(15)10-8-7-9-11-14/h12,15H,7-11H2,1-6H3/b13-12- |
| InChIKey | KAAONWPKPSBHHX-SEYXRHQNSA-N |
| XLogP | 4.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-[(Z)-1,2-bis(trimethylsilyl)ethenyl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z)-1,2-bis(trimethylsilyl)ethenyl]cyclohexan-1-ol?
The IUPAC name of 1-[(Z)-1,2-bis(trimethylsilyl)ethenyl]cyclohexan-1-ol (CID 177433924) is 1-[(Z)-1,2-bis(trimethylsilyl)ethenyl]cyclohexan-1-ol.
What is the SMILES notation for 1-[(Z)-1,2-bis(trimethylsilyl)ethenyl]cyclohexan-1-ol?
The canonical SMILES for 1-[(Z)-1,2-bis(trimethylsilyl)ethenyl]cyclohexan-1-ol is C[Si](C)(C)/C=C(/C1(O)CCCCC1)[Si](C)(C)C.
What is the InChIKey of 1-[(Z)-1,2-bis(trimethylsilyl)ethenyl]cyclohexan-1-ol?
The InChIKey is KAAONWPKPSBHHX-SEYXRHQNSA-N. The full InChI is InChI=1S/C14H30OSi2/c1-16(2,3)12-13(17(4,5)6)14(15)10-8-7-9-11-14/h12,15H,7-11H2,1-6H3/b13-12-.
What are the key properties of 1-[(Z)-1,2-bis(trimethylsilyl)ethenyl]cyclohexan-1-ol?
1-[(Z)-1,2-bis(trimethylsilyl)ethenyl]cyclohexan-1-ol has a molecular weight of 270.56 g/mol, XLogP of 4.36, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z)-1,2-bis(trimethylsilyl)ethenyl]cyclohexan-1-ol is sourced from PubChem (CID 177433924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).