C34H32O8 — CID 177434357
[26,28-dihydroxy-27-(2-methoxyacetyl)oxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaenyl] 2-methoxyacetate (PubChem CID 177434357) has the molecular formula C34H32O8 and a molecular weight of 568.62 g/mol. Its IUPAC name is [26,28-dihydroxy-27-(2-methoxyacetyl)oxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaenyl] 2-methoxyacetate.
| Compound Name | [26,28-dihydroxy-27-(2-methoxyacetyl)oxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaenyl] 2-methoxyacetate |
|---|---|
| PubChem CID | 177434357 |
| Molecular Formula | C34H32O8 |
| Molecular Weight | 568.62 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | [26,28-dihydroxy-27-(2-methoxyacetyl)oxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaenyl] 2-methoxyacetate |
| SMILES | COCC(=O)Oc1c2cccc1Cc1cccc(c1O)Cc1cccc(c1OC(=O)COC)Cc1cccc(c1O)C2 |
| InChI | InChI=1S/C34H32O8/c1-39-19-29(35)41-33-25-11-5-12-26(33)16-22-8-4-10-24(32(22)38)18-28-14-6-13-27(34(28)42-30(36)20-40-2)17-23-9-3-7-21(15-25)31(23)37/h3-14,37-38H,15-20H2,1-2H3 |
| InChIKey | XTULEEHFPOAJLO-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.62 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|