C21H26IN3 — CID 177434989
(2S,8S)-2,8-dibenzyl-1,2,3,4,6,7,8,9-octahydropyrimido[1,2-a]pyrimidin-5-ium iodide (PubChem CID 177434989) has the molecular formula C21H26IN3 and a molecular weight of 447.36 g/mol. Its IUPAC name is (2S,8S)-2,8-dibenzyl-1,2,3,4,6,7,8,9-octahydropyrimido[1,2-a]pyrimidin-5-ium iodide.
| Compound Name | (2S,8S)-2,8-dibenzyl-1,2,3,4,6,7,8,9-octahydropyrimido[1,2-a]pyrimidin-5-ium iodide |
|---|---|
| PubChem CID | 177434989 |
| Molecular Formula | C21H26IN3 |
| Molecular Weight | 447.36 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | (2S,8S)-2,8-dibenzyl-1,2,3,4,6,7,8,9-octahydropyrimido[1,2-a]pyrimidin-5-ium iodide |
| SMILES | [I-].c1ccc(C[C@H]2CC[N+]3=C(N2)N[C@@H](Cc2ccccc2)CC3)cc1 |
| InChI | InChI=1S/C21H25N3.HI/c1-3-7-17(8-4-1)15-19-11-13-24-14-12-20(23-21(24)22-19)16-18-9-5-2-6-10-18;/h1-10,19-20H,11-16H2,(H,22,23);1H/t19-,20-;/m1./s1 |
| InChIKey | ZKTGFSHSHDJVIW-GZJHNZOKSA-N |
| XLogP | -0.43 |
| TPSA | 27.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.36 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|