About (6S)-5-benzyl-10-methyl-6-phenylbenzo[c][2,1]benzazaphosphinine 6-oxide
(6S)-5-benzyl-10-methyl-6-phenylbenzo[c][2,1]benzazaphosphinine 6-oxide (PubChem CID 177435233) has the molecular formula C26H22NOP
and a molecular weight of 395.44 g/mol. Its IUPAC name is (6S)-5-benzyl-10-methyl-6-phenylbenzo[c][2,1]benzazaphosphinine 6-oxide.
Molecular Properties
| Compound Name | (6S)-5-benzyl-10-methyl-6-phenylbenzo[c][2,1]benzazaphosphinine 6-oxide |
| PubChem CID | 177435233 |
| Molecular Formula | C26H22NOP |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | (6S)-5-benzyl-10-methyl-6-phenylbenzo[c][2,1]benzazaphosphinine 6-oxide |
| SMILES | Cc1cccc2c1-c1ccccc1N(Cc1ccccc1)[P@]2(=O)c1ccccc1 |
| InChI | InChI=1S/C26H22NOP/c1-20-11-10-18-25-26(20)23-16-8-9-17-24(23)27(19-21-12-4-2-5-13-21)29(25,28)22-14-6-3-7-15-22/h2-18H,19H2,1H3/t29-/m0/s1 |
| InChIKey | XLERADMMDIMUEL-LJAQVGFWSA-N |
| XLogP | 5.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (6S)-5-benzyl-10-methyl-6-phenylbenzo[c][2,1]benzazaphosphinine 6-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-5-benzyl-10-methyl-6-phenylbenzo[c][2,1]benzazaphosphinine 6-oxide?
The IUPAC name of (6S)-5-benzyl-10-methyl-6-phenylbenzo[c][2,1]benzazaphosphinine 6-oxide (CID 177435233) is (6S)-5-benzyl-10-methyl-6-phenylbenzo[c][2,1]benzazaphosphinine 6-oxide.
What is the SMILES notation for (6S)-5-benzyl-10-methyl-6-phenylbenzo[c][2,1]benzazaphosphinine 6-oxide?
The canonical SMILES for (6S)-5-benzyl-10-methyl-6-phenylbenzo[c][2,1]benzazaphosphinine 6-oxide is Cc1cccc2c1-c1ccccc1N(Cc1ccccc1)[P@]2(=O)c1ccccc1.
What is the InChIKey of (6S)-5-benzyl-10-methyl-6-phenylbenzo[c][2,1]benzazaphosphinine 6-oxide?
The InChIKey is XLERADMMDIMUEL-LJAQVGFWSA-N. The full InChI is InChI=1S/C26H22NOP/c1-20-11-10-18-25-26(20)23-16-8-9-17-24(23)27(19-21-12-4-2-5-13-21)29(25,28)22-14-6-3-7-15-22/h2-18H,19H2,1H3/t29-/m0/s1.
What are the key properties of (6S)-5-benzyl-10-methyl-6-phenylbenzo[c][2,1]benzazaphosphinine 6-oxide?
(6S)-5-benzyl-10-methyl-6-phenylbenzo[c][2,1]benzazaphosphinine 6-oxide has a molecular weight of 395.44 g/mol, XLogP of 5.91, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-5-benzyl-10-methyl-6-phenylbenzo[c][2,1]benzazaphosphinine 6-oxide is sourced from PubChem (CID 177435233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).