About ethyl (E)-5-[(1S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-oxocyclobutyl]pent-2-enoate
ethyl (E)-5-[(1S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-oxocyclobutyl]pent-2-enoate (PubChem CID 177435463) has the molecular formula C18H32O4Si
and a molecular weight of 340.54 g/mol. Its IUPAC name is ethyl (E)-5-[(1S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-oxocyclobutyl]pent-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-5-[(1S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-oxocyclobutyl]pent-2-enoate |
| PubChem CID | 177435463 |
| Molecular Formula | C18H32O4Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | ethyl (E)-5-[(1S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-oxocyclobutyl]pent-2-enoate |
| SMILES | CCOC(=O)/C=C/CC[C@@]1(C)C[C@H](O[Si](C)(C)C(C)(C)C)C1=O |
| InChI | InChI=1S/C18H32O4Si/c1-8-21-15(19)11-9-10-12-18(5)13-14(16(18)20)22-23(6,7)17(2,3)4/h9,11,14H,8,10,12-13H2,1-7H3/b11-9+/t14-,18-/m0/s1 |
| InChIKey | XCIKHPNYFSXESL-ATLZPXGXSA-N |
| XLogP | 4.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-5-[(1S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-oxocyclobutyl]pent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-5-[(1S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-oxocyclobutyl]pent-2-enoate?
The IUPAC name of ethyl (E)-5-[(1S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-oxocyclobutyl]pent-2-enoate (CID 177435463) is ethyl (E)-5-[(1S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-oxocyclobutyl]pent-2-enoate.
What is the SMILES notation for ethyl (E)-5-[(1S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-oxocyclobutyl]pent-2-enoate?
The canonical SMILES for ethyl (E)-5-[(1S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-oxocyclobutyl]pent-2-enoate is CCOC(=O)/C=C/CC[C@@]1(C)C[C@H](O[Si](C)(C)C(C)(C)C)C1=O.
What is the InChIKey of ethyl (E)-5-[(1S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-oxocyclobutyl]pent-2-enoate?
The InChIKey is XCIKHPNYFSXESL-ATLZPXGXSA-N. The full InChI is InChI=1S/C18H32O4Si/c1-8-21-15(19)11-9-10-12-18(5)13-14(16(18)20)22-23(6,7)17(2,3)4/h9,11,14H,8,10,12-13H2,1-7H3/b11-9+/t14-,18-/m0/s1.
What are the key properties of ethyl (E)-5-[(1S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-oxocyclobutyl]pent-2-enoate?
ethyl (E)-5-[(1S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-oxocyclobutyl]pent-2-enoate has a molecular weight of 340.54 g/mol, XLogP of 4.26, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-5-[(1S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-oxocyclobutyl]pent-2-enoate is sourced from PubChem (CID 177435463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).