C23H27NO4 — CID 177435488
(2E,6E)-N-(2-hydroxyethyl)-2,6-dimethyl-8-(3-methyl-1,4-dioxonaphthalen-2-yl)octa-2,6-dienamide (PubChem CID 177435488) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is (2E,6E)-N-(2-hydroxyethyl)-2,6-dimethyl-8-(3-methyl-1,4-dioxonaphthalen-2-yl)octa-2,6-dienamide.
| Compound Name | (2E,6E)-N-(2-hydroxyethyl)-2,6-dimethyl-8-(3-methyl-1,4-dioxonaphthalen-2-yl)octa-2,6-dienamide |
|---|---|
| PubChem CID | 177435488 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | (2E,6E)-N-(2-hydroxyethyl)-2,6-dimethyl-8-(3-methyl-1,4-dioxonaphthalen-2-yl)octa-2,6-dienamide |
| SMILES | CC1=C(C/C=C(\C)CC/C=C(\C)C(=O)NCCO)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H27NO4/c1-15(7-6-8-16(2)23(28)24-13-14-25)11-12-18-17(3)21(26)19-9-4-5-10-20(19)22(18)27/h4-5,8-11,25H,6-7,12-14H2,1-3H3,(H,24,28)/b15-11+,16-8+ |
| InChIKey | VOKTYYULMGZBBF-ZYHSJPTQSA-N |
| XLogP | 3.55 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|