C22H40O2Si — CID 177435591
3-[(3aE,6R,9S,9aS)-9-propyl-1,3,5,6,9,9a-hexahydrocycloocta[c]furan-6-yl]propoxy-tert-butyl-dimethylsilane (PubChem CID 177435591) has the molecular formula C22H40O2Si and a molecular weight of 364.65 g/mol. Its IUPAC name is 3-[(3aE,6R,9S,9aS)-9-propyl-1,3,5,6,9,9a-hexahydrocycloocta[c]furan-6-yl]propoxy-tert-butyl-dimethylsilane.
| Compound Name | 3-[(3aE,6R,9S,9aS)-9-propyl-1,3,5,6,9,9a-hexahydrocycloocta[c]furan-6-yl]propoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 177435591 |
| Molecular Formula | C22H40O2Si |
| Molecular Weight | 364.65 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | 3-[(3aE,6R,9S,9aS)-9-propyl-1,3,5,6,9,9a-hexahydrocycloocta[c]furan-6-yl]propoxy-tert-butyl-dimethylsilane |
| SMILES | CCC[C@H]1C=C[C@H](CCCO[Si](C)(C)C(C)(C)C)C/C=C2/COC[C@H]21 |
| InChI | InChI=1S/C22H40O2Si/c1-7-9-19-13-11-18(12-14-20-16-23-17-21(19)20)10-8-15-24-25(5,6)22(2,3)4/h11,13-14,18-19,21H,7-10,12,15-17H2,1-6H3/b13-11?,20-14-/t18-,19-,21-/m0/s1 |
| InChIKey | JCUQFNKSLBRSDG-HYIBMIHUSA-N |
| XLogP | 6.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.65 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|