About (Z)-3-hexyl-N-(1,3-thiazol-2-yl)isochromen-1-imine
(Z)-3-hexyl-N-(1,3-thiazol-2-yl)isochromen-1-imine (PubChem CID 177435599) has the molecular formula C18H20N2OS
and a molecular weight of 312.44 g/mol. Its IUPAC name is (Z)-3-hexyl-N-(1,3-thiazol-2-yl)isochromen-1-imine.
Molecular Properties
| Compound Name | (Z)-3-hexyl-N-(1,3-thiazol-2-yl)isochromen-1-imine |
| PubChem CID | 177435599 |
| Molecular Formula | C18H20N2OS |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | (Z)-3-hexyl-N-(1,3-thiazol-2-yl)isochromen-1-imine |
| SMILES | CCCCCCc1cc2ccccc2/c(=N/c2nccs2)o1 |
| InChI | InChI=1S/C18H20N2OS/c1-2-3-4-5-9-15-13-14-8-6-7-10-16(14)17(21-15)20-18-19-11-12-22-18/h6-8,10-13H,2-5,9H2,1H3/b20-17- |
| InChIKey | SVQCDNUPWYZYHN-JZJYNLBNSA-N |
| XLogP | 5.24 |
| TPSA | 38.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-hexyl-N-(1,3-thiazol-2-yl)isochromen-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-hexyl-N-(1,3-thiazol-2-yl)isochromen-1-imine?
The IUPAC name of (Z)-3-hexyl-N-(1,3-thiazol-2-yl)isochromen-1-imine (CID 177435599) is (Z)-3-hexyl-N-(1,3-thiazol-2-yl)isochromen-1-imine.
What is the SMILES notation for (Z)-3-hexyl-N-(1,3-thiazol-2-yl)isochromen-1-imine?
The canonical SMILES for (Z)-3-hexyl-N-(1,3-thiazol-2-yl)isochromen-1-imine is CCCCCCc1cc2ccccc2/c(=N/c2nccs2)o1.
What is the InChIKey of (Z)-3-hexyl-N-(1,3-thiazol-2-yl)isochromen-1-imine?
The InChIKey is SVQCDNUPWYZYHN-JZJYNLBNSA-N. The full InChI is InChI=1S/C18H20N2OS/c1-2-3-4-5-9-15-13-14-8-6-7-10-16(14)17(21-15)20-18-19-11-12-22-18/h6-8,10-13H,2-5,9H2,1H3/b20-17-.
What are the key properties of (Z)-3-hexyl-N-(1,3-thiazol-2-yl)isochromen-1-imine?
(Z)-3-hexyl-N-(1,3-thiazol-2-yl)isochromen-1-imine has a molecular weight of 312.44 g/mol, XLogP of 5.24, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-hexyl-N-(1,3-thiazol-2-yl)isochromen-1-imine is sourced from PubChem (CID 177435599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).